CAS 1416981-88-8 appears in our catalog under these names: 1–Methyl–3–(4–methylbenzyl)–1H–indole, 1-Methyl-3-(4-methylbenzyl)-1H-indole, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
1-methyl-3-[(4-methylphenyl)methyl]indole (CAS 1416981-88-8) is a chemical compound with the molecular formula C17H17N and a molecular weight of 235.32 g/mol. IUPAC name: 1-methyl-3-[(4-methylphenyl)methyl]indole. InChIKey: MDUSZKHODKKFJQ-UHFFFAOYSA-N.
| Molecular formula | C17H17N |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 1-methyl-3-[(4-methylphenyl)methyl]indole |
| InChIKey | MDUSZKHODKKFJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CN(C3=CC=CC=C32)C |
Computed by PubChem (NCBI)