CAS 1417201-88-7 is the registry number for (3R,4S)-3,4-Bis(ethoxycarbonyl)hexanedioic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3R,4S)-3,4-bis(ethoxycarbonyl)hexanedioic acid (CAS 1417201-88-7) is a chemical compound with the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. IUPAC name: (3R,4S)-3,4-bis(ethoxycarbonyl)hexanedioic acid. InChIKey: LUQRYMIICZMAKY-OCAPTIKFSA-N.
| Molecular formula | C12H18O8 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (3R,4S)-3,4-bis(ethoxycarbonyl)hexanedioic acid |
| InChIKey | LUQRYMIICZMAKY-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@H](CC(=O)O)[C@H](CC(=O)O)C(=O)OCC |
Computed by PubChem (NCBI)