Products 32453-58-0
CAS 32453-58-0 is the registry number for (2S,3S,4R,5R)-2-Methoxytetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate (CAS 32453-58-0) is a chemical compound with the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. IUPAC name: [(3R,4R,5S,6S)-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate. InChIKey: YBESHGJFPWHRBW-WYUUTHIRSA-N.
| Molecular formula | C12H18O8 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate |
| InChIKey | YBESHGJFPWHRBW-WYUUTHIRSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC |
Computed by PubChem (NCBI)