CAS 1417563-66-6 is the registry number for (1R)-1-[(2S,3R,4R)-3,4-dihydroxy-5-methoxy-4-methyloxolan-2-yl]ethyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-[(2S,3R,4R)-3,4-dihydroxy-5-methoxy-4-methyloxolan-2-yl]ethyl] benzoate (CAS 1417563-66-6) is a chemical compound with the molecular formula C15H20O6 and a molecular weight of 296.31 g/mol. IUPAC name: [(1R)-1-[(2S,3R,4R)-3,4-dihydroxy-5-methoxy-4-methyloxolan-2-yl]ethyl] benzoate. InChIKey: XEVYDBYNWCACHT-LDBRXZITSA-N.
| Molecular formula | C15H20O6 |
|---|---|
| Molecular weight | 296.31 g/mol |
| IUPAC name | [(1R)-1-[(2S,3R,4R)-3,4-dihydroxy-5-methoxy-4-methyloxolan-2-yl]ethyl] benzoate |
| InChIKey | XEVYDBYNWCACHT-LDBRXZITSA-N |
| SMILES | C[C@H]([C@@H]1[C@H]([C@@](C(O1)OC)(C)O)O)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)