Products 80973-66-6
CAS 80973-66-6 appears in our catalog under these names: (2R,3R,4R,5R)–5–(benzyloxy)–3–hydroxy–2–methoxytetrahydro–2H–pyran–4–yl acetate, Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 250mg.
[(2R,3R,4R,5R)-3-hydroxy-2-methoxy-5-phenylmethoxyoxan-4-yl] acetate (CAS 80973-66-6) is a chemical compound with the molecular formula C15H20O6 and a molecular weight of 296.31 g/mol. IUPAC name: [(2R,3R,4R,5R)-3-hydroxy-2-methoxy-5-phenylmethoxyoxan-4-yl] acetate. InChIKey: SDICTYMPQVSHQI-APIJFGDWSA-N.
| Molecular formula | C15H20O6 |
|---|---|
| Molecular weight | 296.31 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3-hydroxy-2-methoxy-5-phenylmethoxyoxan-4-yl] acetate |
| InChIKey | SDICTYMPQVSHQI-APIJFGDWSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](CO[C@H]([C@@H]1O)OC)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)