CAS 1417568-42-3 is the registry number for 4-(4-Chlorophenyl)piperazine-1-carboximidamide sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid (CAS 1417568-42-3) is a chemical compound with the molecular formula C11H17ClN4O4S and a molecular weight of 336.80 g/mol. IUPAC name: 4-(4-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid. InChIKey: ABOBDSBOGSWGAQ-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN4O4S |
|---|---|
| Molecular weight | 336.80 g/mol |
| IUPAC name | 4-(4-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid |
| InChIKey | ABOBDSBOGSWGAQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)Cl)C(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)