Products 1417569-95-9

CAS 1417569-95-9 is the registry number for 4-(3-Chlorophenyl)piperazine-1-carboximidamide sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(3-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid (CAS 1417569-95-9) is a chemical compound with the molecular formula C11H17ClN4O4S and a molecular weight of 336.80 g/mol. IUPAC name: 4-(3-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid. InChIKey: FIBUUAHYNKSTJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN4O4S
Molecular weight336.80 g/mol
IUPAC name4-(3-chlorophenyl)piperazine-1-carboximidamide;sulfuric acid
InChIKeyFIBUUAHYNKSTJQ-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC(=CC=C2)Cl)C(=N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)