Products 1417789-26-4
CAS 1417789-26-4 is the registry number for (R)-tert-Butyl 3-((6-aminopyrazin-2-yl)oxy)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R)-3-(6-aminopyrazin-2-yl)oxypiperidine-1-carboxylate (CAS 1417789-26-4) is a chemical compound with the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl (3R)-3-(6-aminopyrazin-2-yl)oxypiperidine-1-carboxylate. InChIKey: GIHFUWYGGUNZCV-SNVBAGLBSA-N.
| Molecular formula | C14H22N4O3 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | tert-butyl (3R)-3-(6-aminopyrazin-2-yl)oxypiperidine-1-carboxylate |
| InChIKey | GIHFUWYGGUNZCV-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)OC2=NC(=CN=C2)N |
Computed by PubChem (NCBI)