Products 865279-86-3
CAS 865279-86-3 is the registry number for 4-{(3-(Diethylamino)propyl)amino}-3-nitrobenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[3-(diethylamino)propylamino]-3-nitrobenzamide (CAS 865279-86-3) is a chemical compound with the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. IUPAC name: 4-[3-(diethylamino)propylamino]-3-nitrobenzamide. InChIKey: VQGURKBCDLMKIT-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O3 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | 4-[3-(diethylamino)propylamino]-3-nitrobenzamide |
| InChIKey | VQGURKBCDLMKIT-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNC1=C(C=C(C=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)