CAS 1417793-81-7 is the registry number for Thiophene–3–carboxylic acid (1–(2–chloro–acetyl)–piperidin–3–yl)–aMide. Offered by: GLPBio. Available pack sizes: 1g.
N-[1-(2-chloroacetyl)piperidin-3-yl]thiophene-3-carboxamide (CAS 1417793-81-7) is a chemical compound with the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. IUPAC name: N-[1-(2-chloroacetyl)piperidin-3-yl]thiophene-3-carboxamide. InChIKey: HVAGRMQBCIQYKK-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2S |
|---|---|
| Molecular weight | 286.78 g/mol |
| IUPAC name | N-[1-(2-chloroacetyl)piperidin-3-yl]thiophene-3-carboxamide |
| InChIKey | HVAGRMQBCIQYKK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)CCl)NC(=O)C2=CSC=C2 |
Computed by PubChem (NCBI)