CAS 1499483-47-4 is the registry number for 3-(6-Chloro-3,4-dihydroquinoxalin-1(2H)-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-chloro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide (CAS 1499483-47-4) is a chemical compound with the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. IUPAC name: 3-(6-chloro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide. InChIKey: NMLOORLJXFNGAQ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2S |
|---|---|
| Molecular weight | 286.78 g/mol |
| IUPAC name | 3-(6-chloro-3,4-dihydro-2H-quinoxalin-1-yl)thiolane 1,1-dioxide |
| InChIKey | NMLOORLJXFNGAQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCNC3=C2C=CC(=C3)Cl |
Computed by PubChem (NCBI)