Products 141794-74-3
CAS 141794-74-3 is the registry number for L-Alanine-1-13C,15N, 98%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(2S)-2-(15N)azanyl(113C)propanoic acid (CAS 141794-74-3) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 91.08 g/mol. IUPAC name: (2S)-2-(15N)azanyl(113C)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-WGVUESGYSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 91.08 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl(113C)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-WGVUESGYSA-N |
| SMILES | C[C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)