CAS 141801-46-9 appears in our catalog under these names: Acetanilide-d6, >95% (HPLC), N–deuterio–N–(2,3,4,5,6–pentadeuteriophenyl)acetamide. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 50mg, 10mg.
N-deuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide (CAS 141801-46-9) is a chemical compound with the molecular formula C8H9NO and a molecular weight of 141.20 g/mol. IUPAC name: N-deuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide. InChIKey: FZERHIULMFGESH-TYSUPAQWSA-N.
| Molecular formula | C8H9NO |
|---|---|
| Molecular weight | 141.20 g/mol |
| IUPAC name | N-deuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide |
| InChIKey | FZERHIULMFGESH-TYSUPAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N([2H])C(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)