CAS 22778-17-2 appears in our catalog under these names: Acetanilide-d8, >95% (HPLC), Acetanilide-d8, 99 atom % D, min 98% Chemical Purity, Acetanilide–d3. Offered by: TRC, CDN, GLPBio. Available pack sizes: 500mg, 1g, 0,5g, 10mg.
2,2,2-trideuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide (CAS 22778-17-2) is a chemical compound with the molecular formula C8H9NO and a molecular weight of 143.21 g/mol. IUPAC name: 2,2,2-trideuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide. InChIKey: FZERHIULMFGESH-JGUCLWPXSA-N.
| Molecular formula | C8H9NO |
|---|---|
| Molecular weight | 143.21 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide |
| InChIKey | FZERHIULMFGESH-JGUCLWPXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)