CAS 1418095-22-3 is the registry number for Penconazole Metabolite CGA 179944, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid (CAS 1418095-22-3) is a chemical compound with the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.11 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid. InChIKey: MFGQUIFCNUUDBI-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3O2 |
|---|---|
| Molecular weight | 286.11 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid |
| InChIKey | MFGQUIFCNUUDBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)