Products 1418095-22-3

CAS 1418095-22-3 is the registry number for Penconazole Metabolite CGA 179944, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.

Structural formula: {0} (CAS {1})

2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid (CAS 1418095-22-3) is a chemical compound with the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.11 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid. InChIKey: MFGQUIFCNUUDBI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9Cl2N3O2
Molecular weight286.11 g/mol
IUPAC name2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propanoic acid
InChIKeyMFGQUIFCNUUDBI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)C(CN2C=NC=N2)C(=O)O

Computed by PubChem (NCBI)