Products 1491085-84-7

CAS 1491085-84-7 is the registry number for Ethyl 5-(2,4-dichlorophenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1491085-84-7) is a chemical compound with the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.11 g/mol. IUPAC name: ethyl 3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: YZAZRRPKPZOZQY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9Cl2N3O2
Molecular weight286.11 g/mol
IUPAC nameethyl 3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate
InChIKeyYZAZRRPKPZOZQY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NN1)C2=C(C=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)