Products 1418129-68-6
CAS 1418129-68-6 is the registry number for 6-Formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 1418129-68-6) is a chemical compound with the molecular formula C13H17BN2O4 and a molecular weight of 276.10 g/mol. IUPAC name: 6-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: MQQMIDCABSDBPL-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O4 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | 6-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | MQQMIDCABSDBPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)C(=O)N)C=O |
Computed by PubChem (NCBI)