CAS 1418209-88-7 is the registry number for (S)-5-Bromo-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (CAS 1418209-88-7) is a chemical compound with the molecular formula C13H9BrN2O4 and a molecular weight of 337.12 g/mol. IUPAC name: 5-bromo-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione. InChIKey: MWMSBQXTHIEBNT-VIFPVBQESA-N.
| Molecular formula | C13H9BrN2O4 |
|---|---|
| Molecular weight | 337.12 g/mol |
| IUPAC name | 5-bromo-2-[(3S)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| InChIKey | MWMSBQXTHIEBNT-VIFPVBQESA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)