CAS 1800345-13-4 is the registry number for Methyl 4-(5-bromo-3-nitropyridin-2-yl)benzoate, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
Methyl 4-(5-bromo-3-nitro-2-pyridinyl)benzoate (CAS 1800345-13-4) is a chemical compound with the molecular formula C13H9BrN2O4 and a molecular weight of 337.12 g/mol. IUPAC name: methyl 4-(5-bromo-3-nitro-2-pyridinyl)benzoate. InChIKey: RTGYGUKKUVKIMW-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2O4 |
|---|---|
| Molecular weight | 337.12 g/mol |
| IUPAC name | methyl 4-(5-bromo-3-nitro-2-pyridinyl)benzoate |
| InChIKey | RTGYGUKKUVKIMW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(C=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)