CAS 1418554-01-4 is the registry number for 1-Methylethyl 3-Chloro-4-methylbenzoate. Offered by: TRC. Available pack sizes: 5g.
Propan-2-yl 3-chloro-4-methylbenzoate (CAS 1418554-01-4) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: propan-2-yl 3-chloro-4-methylbenzoate. InChIKey: RODCVSHNESCUTL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | propan-2-yl 3-chloro-4-methylbenzoate |
| InChIKey | RODCVSHNESCUTL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC(C)C)Cl |
Computed by PubChem (NCBI)