CAS 14186-52-8 appears in our catalog under these names: 1,4-Dimethyl 2-amino-3-methylbenzene-1,4-dicarboxylate, 95%, 1,4-Dimethyl 2-amino-3-methylbenzene-1,4-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Dimethyl 2-amino-3-methylbenzene-1,4-dicarboxylate (CAS 14186-52-8) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: dimethyl 2-amino-3-methylbenzene-1,4-dicarboxylate. InChIKey: QAFWKEDPMYHBGU-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | dimethyl 2-amino-3-methylbenzene-1,4-dicarboxylate |
| InChIKey | QAFWKEDPMYHBGU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1N)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)