CAS 1419075-83-4 is the registry number for 4-Bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
4-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid (CAS 1419075-83-4) is a chemical compound with the molecular formula C8H3BrF4O3 and a molecular weight of 303.00 g/mol. IUPAC name: 4-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid. InChIKey: IXFAQDWACWVXRW-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O3 |
|---|---|
| Molecular weight | 303.00 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | IXFAQDWACWVXRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)OC(F)(F)F)Br |
Computed by PubChem (NCBI)