CAS 524674-71-3 appears in our catalog under these names: 6–Bromo–2–fluoro–3–(trifluoromethoxy)benzoic acid, 6-Bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid, 6-Bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid, 95%, 6-Bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid, 98%, 98%, 6-BROMO-2-FLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
6-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid (CAS 524674-71-3) is a chemical compound with the molecular formula C8H3BrF4O3 and a molecular weight of 303.00 g/mol. IUPAC name: 6-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid. InChIKey: PMHZGWJIYADKFG-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O3 |
|---|---|
| Molecular weight | 303.00 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | PMHZGWJIYADKFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC(F)(F)F)F)C(=O)O)Br |
Computed by PubChem (NCBI)