CAS 1419075-84-5 is the registry number for 4-Bromo-2-chloro-5-trifluoromethoxy-benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-bromo-2-chloro-5-(trifluoromethoxy)benzoic acid (CAS 1419075-84-5) is a chemical compound with the molecular formula C8H3BrClF3O3 and a molecular weight of 319.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: FXGHMQFEQHOELI-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O3 |
|---|---|
| Molecular weight | 319.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | FXGHMQFEQHOELI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)