Products 2167664-93-7
CAS 2167664-93-7 is the registry number for 3-Bromo-2-chloro-6-(trifluoromethoxy)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-2-chloro-6-(trifluoromethoxy)benzoic acid (CAS 2167664-93-7) is a chemical compound with the molecular formula C8H3BrClF3O3 and a molecular weight of 319.46 g/mol. IUPAC name: 3-bromo-2-chloro-6-(trifluoromethoxy)benzoic acid. InChIKey: QUNDOHBGRMQSJM-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O3 |
|---|---|
| Molecular weight | 319.46 g/mol |
| IUPAC name | 3-bromo-2-chloro-6-(trifluoromethoxy)benzoic acid |
| InChIKey | QUNDOHBGRMQSJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC(F)(F)F)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)