CAS 1419100-97-2 is the registry number for (S)-2,2-dimethyl-1-(3-methylpiperazin-1-yl)propan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-dimethyl-1-[(3S)-3-methylpiperazin-1-yl]propan-1-one (CAS 1419100-97-2) is a chemical compound with the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. IUPAC name: 2,2-dimethyl-1-[(3S)-3-methylpiperazin-1-yl]propan-1-one. InChIKey: XCVMVRBLFPBDIN-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O |
|---|---|
| Molecular weight | 184.28 g/mol |
| IUPAC name | 2,2-dimethyl-1-[(3S)-3-methylpiperazin-1-yl]propan-1-one |
| InChIKey | XCVMVRBLFPBDIN-QMMMGPOBSA-N |
| SMILES | C[C@H]1CN(CCN1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)