Products 909409-91-2
CAS 909409-91-2 appears in our catalog under these names: (R)-4-TERT-BUTYLCARBONYL-2-METHYLPIPERAZINE, 98%, (R)-2-Methyl-4-tert-butyl carbonylpiperazine, 95%, (R)–2，2–Dimethyl–1–(3–methylpiperazin–1–yl)propan–1–one, (R)-2-Methyl-4-tert-butyl carbonylpiperazine, 98%, 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
2,2-dimethyl-1-[(3R)-3-methylpiperazin-1-yl]propan-1-one (CAS 909409-91-2) is a chemical compound with the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. IUPAC name: 2,2-dimethyl-1-[(3R)-3-methylpiperazin-1-yl]propan-1-one. InChIKey: XCVMVRBLFPBDIN-MRVPVSSYSA-N.
| Molecular formula | C10H20N2O |
|---|---|
| Molecular weight | 184.28 g/mol |
| IUPAC name | 2,2-dimethyl-1-[(3R)-3-methylpiperazin-1-yl]propan-1-one |
| InChIKey | XCVMVRBLFPBDIN-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CN(CCN1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)