CAS 1419101-34-0 appears in our catalog under these names: Methyl exo-3-boc-3-azabicyclo[3.1.0]hexane-6-carboxylate, 96%, exo-3-tert-Butyl 6-methyl 3-azabicyclo(3.1.0)hexane-3,6-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
3-O-tert-butyl 6-O-methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate (CAS 1419101-34-0) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 3-O-tert-butyl 6-O-methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate. InChIKey: NJKNDGQUFLNXNJ-JVHMLUBASA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-O-tert-butyl 6-O-methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate |
| InChIKey | NJKNDGQUFLNXNJ-JVHMLUBASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2C(=O)OC |
Computed by PubChem (NCBI)