Products 1419222-80-2
CAS 1419222-80-2 is the registry number for methyl 3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazole-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazole-5-carboxylate (CAS 1419222-80-2) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: methyl 3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazole-5-carboxylate. InChIKey: SVJUGGPMGRDVBL-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | methyl 3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazole-5-carboxylate |
| InChIKey | SVJUGGPMGRDVBL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=C(C1)C(=NN2)C3CC3 |
Computed by PubChem (NCBI)