CAS 14195-09-6 appears in our catalog under these names: 2-[(4-Methylbenzene)sulfonyl]cyclohexan-1-one, 95%, 2-(4-Methylbenzenesulfonyl)cyclohexan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-(4-methylphenyl)sulfonylcyclohexan-1-one (CAS 14195-09-6) is a chemical compound with the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylcyclohexan-1-one. InChIKey: AAACOSUXEVDPSL-UHFFFAOYSA-N.
| Molecular formula | C13H16O3S |
|---|---|
| Molecular weight | 252.33 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylcyclohexan-1-one |
| InChIKey | AAACOSUXEVDPSL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2CCCCC2=O |
Computed by PubChem (NCBI)