CAS 404582-98-5 appears in our catalog under these names: (R)-Ethyl 2-(acetylthio)-3-phenylpropanoate, 97%, Ethyl R-2-Acetylthio-3-phenylpropionate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 2g, 500mg.
Ethyl (2R)-2-acetylsulfanyl-3-phenylpropanoate (CAS 404582-98-5) is a chemical compound with the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. IUPAC name: ethyl (2R)-2-acetylsulfanyl-3-phenylpropanoate. InChIKey: UPMARCACLHHTCO-GFCCVEGCSA-N.
| Molecular formula | C13H16O3S |
|---|---|
| Molecular weight | 252.33 g/mol |
| IUPAC name | ethyl (2R)-2-acetylsulfanyl-3-phenylpropanoate |
| InChIKey | UPMARCACLHHTCO-GFCCVEGCSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CC=CC=C1)SC(=O)C |
Computed by PubChem (NCBI)