Products 141978-97-4

CAS 141978-97-4 is the registry number for 3,3-Dimethyl-5-oxopyrrolidine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 50mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid (CAS 141978-97-4) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: 3,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid. InChIKey: TVZZAWCQMQIZOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO3
Molecular weight157.17 g/mol
IUPAC name3,3-dimethyl-5-oxopyrrolidine-2-carboxylic acid
InChIKeyTVZZAWCQMQIZOO-UHFFFAOYSA-N
SMILESCC1(CC(=O)NC1C(=O)O)C

Computed by PubChem (NCBI)