CAS 141990-24-1 appears in our catalog under these names: (2R,3R,4R,5S,6R)–5–fluoro–6–(hydroxymethyl)–2–methoxytetrahydro–2H–pyran–3,4–diol, Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 250mg.
(2R,3S,5S)-5-fluoro-6-(hydroxymethyl)-2-methoxyoxane-3,4-diol (CAS 141990-24-1) is a chemical compound with the molecular formula C7H13FO5 and a molecular weight of 196.17 g/mol. IUPAC name: (2R,3S,5S)-5-fluoro-6-(hydroxymethyl)-2-methoxyoxane-3,4-diol. InChIKey: PGYKOSXDWWGTOB-CWAZNJFBSA-N.
| Molecular formula | C7H13FO5 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (2R,3S,5S)-5-fluoro-6-(hydroxymethyl)-2-methoxyoxane-3,4-diol |
| InChIKey | PGYKOSXDWWGTOB-CWAZNJFBSA-N |
| SMILES | CO[C@H]1[C@H](C([C@@H](C(O1)CO)F)O)O |
Computed by PubChem (NCBI)