Products 77778-66-6

CAS 77778-66-6 is the registry number for Methyl 2-fluoro-3,3,3-trimethoxypropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-fluoro-3,3,3-trimethoxypropanoate (CAS 77778-66-6) is a chemical compound with the molecular formula C7H13FO5 and a molecular weight of 196.17 g/mol. IUPAC name: methyl 2-fluoro-3,3,3-trimethoxypropanoate. InChIKey: OCVWVNNAUUPJJH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13FO5
Molecular weight196.17 g/mol
IUPAC namemethyl 2-fluoro-3,3,3-trimethoxypropanoate
InChIKeyOCVWVNNAUUPJJH-UHFFFAOYSA-N
SMILESCOC(=O)C(C(OC)(OC)OC)F

Computed by PubChem (NCBI)