CAS 142-71-2 appears in our catalog under these names: Cu(OAc)2 (HPMC encapsulated), Copper(II) acetate, 96%, Copper(II) Acetate, Anhydrous, Anhydrous copper acetate, 98%, Copper(II) acetate, 99.999% (metals basis) . Offered by: TCI, Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 10each, 25g, 1kg, 500g, 100g, 5g, 50g, 250g.
Copper diacetate (CAS 142-71-2) is a chemical compound with the molecular formula C4H6CuO4 and a molecular weight of 181.63 g/mol. IUPAC name: copper diacetate. InChIKey: OPQARKPSCNTWTJ-UHFFFAOYSA-L.
| Molecular formula | C4H6CuO4 |
|---|---|
| Molecular weight | 181.63 g/mol |
| IUPAC name | copper diacetate |
| InChIKey | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)