CAS 463931-62-6 is the registry number for Copper(II) Acetate Monohydrate. Offered by: TRC. Available pack sizes: 100g, 250g, 50g.
Copper diacetate (CAS 463931-62-6) is a chemical compound with the molecular formula C4H6CuO4 and a molecular weight of 181.63 g/mol. IUPAC name: copper diacetate. InChIKey: OPQARKPSCNTWTJ-UHFFFAOYSA-L.
| Molecular formula | C4H6CuO4 |
|---|---|
| Molecular weight | 181.63 g/mol |
| IUPAC name | copper diacetate |
| InChIKey | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)