Products 1420291-59-3
CAS 1420291-59-3 is the registry number for Hydroxyalprazolam-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
[3-hydroxy-5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]phenyl] hydrogen sulfate (CAS 1420291-59-3) is a chemical compound with the molecular formula C14H12O6S and a molecular weight of 312.33 g/mol. IUPAC name: [3-hydroxy-5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]phenyl] hydrogen sulfate. InChIKey: DULQFFCIVGYOFH-RRQWMZAJSA-N.
| Molecular formula | C14H12O6S |
|---|---|
| Molecular weight | 312.33 g/mol |
| IUPAC name | [3-hydroxy-5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]phenyl] hydrogen sulfate |
| InChIKey | DULQFFCIVGYOFH-RRQWMZAJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1/C=C/C2=CC(=CC(=C2)OS(=O)(=O)O)O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Hydroxyalprazolam-d4, Resveratrol-3-O-sulfate D4