CAS 1420627-35-5 appears in our catalog under these names: (S)-2-(1-Aminoethyl)-5-chloro-3-phenylquinazolin-4(3H)-one, 98%, (S)-2-(1-Aminoethyl)-5-chloro-3-phenylquinazolin-4(3H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 500mg, 250mg.
2-[(1S)-1-aminoethyl]-5-chloro-3-phenylquinazolin-4-one (CAS 1420627-35-5) is a chemical compound with the molecular formula C16H14ClN3O and a molecular weight of 299.75 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-5-chloro-3-phenylquinazolin-4-one. InChIKey: BRTIHPMUDVKVLP-JTQLQIEISA-N.
| Molecular formula | C16H14ClN3O |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-5-chloro-3-phenylquinazolin-4-one |
| InChIKey | BRTIHPMUDVKVLP-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=NC2=C(C(=CC=C2)Cl)C(=O)N1C3=CC=CC=C3)N |
Computed by PubChem (NCBI)