CAS 222838-33-7 appears in our catalog under these names: Pyraclostrobin Impurity 2, 2-(((1-(4-Chlorophenyl)-1H-pyrazol-3-yl)oxy)methyl)benzenamine, 2–(((1–(4–chlorophenyl)–1H–pyrazol–3–yl)oxy)methyl)aniline. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 10mg, 25mg, 5mg, 100mg, 1g, 250mg.
2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]aniline (CAS 222838-33-7) is a chemical compound with the molecular formula C16H14ClN3O and a molecular weight of 299.75 g/mol. IUPAC name: 2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]aniline. InChIKey: LIUOORDMFAVVFQ-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]aniline |
| InChIKey | LIUOORDMFAVVFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=NN(C=C2)C3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)