CAS 1420800-15-2 appears in our catalog under these names: 5-Bromo-6-fluoro-2-methylbenzodiazole hydrochloride, 97%, 5-Bromo-6-fluoro-2-methylbenzodiazole HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
5-bromo-6-fluoro-2-methyl-1H-benzimidazole;hydrochloride (CAS 1420800-15-2) is a chemical compound with the molecular formula C8H7BrClFN2 and a molecular weight of 265.51 g/mol. IUPAC name: 5-bromo-6-fluoro-2-methyl-1H-benzimidazole;hydrochloride. InChIKey: FZJIBHNPKKCPFP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFN2 |
|---|---|
| Molecular weight | 265.51 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2-methyl-1H-benzimidazole;hydrochloride |
| InChIKey | FZJIBHNPKKCPFP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1)F)Br.Cl |
Computed by PubChem (NCBI)