CAS 2901948-73-8 is the registry number for 5-Bromo-7-fluoro-1H-indol-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-fluoro-1H-indol-3-amine;hydrochloride (CAS 2901948-73-8) is a chemical compound with the molecular formula C8H7BrClFN2 and a molecular weight of 265.51 g/mol. IUPAC name: 5-bromo-7-fluoro-1H-indol-3-amine;hydrochloride. InChIKey: PQJHWZXDPFBULC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFN2 |
|---|---|
| Molecular weight | 265.51 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1H-indol-3-amine;hydrochloride |
| InChIKey | PQJHWZXDPFBULC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)N)F)Br.Cl |
Computed by PubChem (NCBI)