CAS 1420800-18-5 is the registry number for 4-Bromo-2-nitrobenzene-1,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-2-nitrobenzene-1,3-diamine (CAS 1420800-18-5) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 4-bromo-2-nitrobenzene-1,3-diamine. InChIKey: AETWZHQHNSBJHG-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzene-1,3-diamine |
| InChIKey | AETWZHQHNSBJHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)