CAS 1420820-73-0 is the registry number for tert-Butyl ((1-(1,1-dioxidobenzo[d]isothiazol-3-yl)piperidin-4-yl)methyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]carbamate (CAS 1420820-73-0) is a chemical compound with the molecular formula C18H25N3O4S and a molecular weight of 379.5 g/mol. IUPAC name: tert-butyl N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]carbamate. InChIKey: ABYUAVFRPBIGFP-UHFFFAOYSA-N.
| Molecular formula | C18H25N3O4S |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | tert-butyl N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]methyl]carbamate |
| InChIKey | ABYUAVFRPBIGFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(CC1)C2=NS(=O)(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)