Products 874583-40-1
CAS 874583-40-1 is the registry number for Naratriptan 2-Carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,5mg, 2,5mg, 5mg.
3-(1-methylpiperidin-4-yl)-5-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxylic acid (CAS 874583-40-1) is a chemical compound with the molecular formula C18H25N3O4S and a molecular weight of 379.5 g/mol. IUPAC name: 3-(1-methylpiperidin-4-yl)-5-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxylic acid. InChIKey: VNLHQZYDCHYDDL-UHFFFAOYSA-N.
| Molecular formula | C18H25N3O4S |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 3-(1-methylpiperidin-4-yl)-5-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxylic acid |
| InChIKey | VNLHQZYDCHYDDL-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(C=C1)NC(=C2C3CCN(CC3)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Naratriptan 2-Carboxylic Acid