Products 1420977-70-3
CAS 1420977-70-3 is the registry number for [3,5-Bis(trifluoromethyl)phenoxy]propane, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-propoxy-3,5-bis(trifluoromethyl)benzene (CAS 1420977-70-3) is a chemical compound with the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. IUPAC name: 1-propoxy-3,5-bis(trifluoromethyl)benzene. InChIKey: MQAXEOKVHDKGBQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F6O |
|---|---|
| Molecular weight | 272.19 g/mol |
| IUPAC name | 1-propoxy-3,5-bis(trifluoromethyl)benzene |
| InChIKey | MQAXEOKVHDKGBQ-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)