Products 412010-25-4
CAS 412010-25-4 is the registry number for 2-(3,5-Dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 412010-25-4) is a chemical compound with the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: OXPLMDILERTILF-UHFFFAOYSA-N.
| Molecular formula | C11H10F6O |
|---|---|
| Molecular weight | 272.19 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | OXPLMDILERTILF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C(F)(F)F)(C(F)(F)F)O)C |
Computed by PubChem (NCBI)