CAS 14210-51-6 is the registry number for 2-(1H-Tetrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 10g.
2-(tetrazol-1-yl)aniline (CAS 14210-51-6) is a chemical compound with the molecular formula C7H7N5 and a molecular weight of 161.16 g/mol. IUPAC name: 2-(tetrazol-1-yl)aniline. InChIKey: SZZQSRGQFXNPLZ-UHFFFAOYSA-N.
| Molecular formula | C7H7N5 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(tetrazol-1-yl)aniline |
| InChIKey | SZZQSRGQFXNPLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C=NN=N2 |
Computed by PubChem (NCBI)