Products 1421254-59-2
CAS 1421254-59-2 is the registry number for tert-Butyl (R)-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (4R)-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate (CAS 1421254-59-2) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (4R)-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate. InChIKey: QZMUVNRDYLNZDA-SECBINFHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (4R)-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
| InChIKey | QZMUVNRDYLNZDA-SECBINFHSA-N |
| SMILES | CC1(CN(CC[C@H]1O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)