CAS 1421254-66-1 appears in our catalog under these names: (1R,3S,5S)-3-methoxy-8-azabicyclo(3.2.1)octane hydrochloride, endo-3-Methoxy-8-azabicyclo[3.2.1]octane hydrochloride, 97%, 97%, (3-endo)-3-methoxy-8-azabicyclo[3.2.1]octane hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 500mg, 1g, 5g, 10g, 25g, 100mg.
(1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octane;hydrochloride (CAS 1421254-66-1) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: (1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: TUQKVSDUCJVCOI-PAFGHYSMSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | (1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | TUQKVSDUCJVCOI-PAFGHYSMSA-N |
| SMILES | COC1C[C@H]2CC[C@@H](C1)N2.Cl |
Computed by PubChem (NCBI)