CAS 205639-89-0 appears in our catalog under these names: Diendo-(3-amino-bicyclo[2.2.1]hept-2-yl)-methanol hydrochloride, 95%, Diendo-(3-amino-bicyclo(2.2.1)hept-2-yl)-methanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
[(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride (CAS 205639-89-0) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: [(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride. InChIKey: JBSSFLCCAAVUFA-ICDZOTBQSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | [(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride |
| InChIKey | JBSSFLCCAAVUFA-ICDZOTBQSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]([C@H]2N)CO.Cl |
Computed by PubChem (NCBI)